C23H24FNO4 — CID 90827726
propan-2-yl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate (PubChem CID 90827726) has the molecular formula C23H24FNO4 and a molecular weight of 397.45 g/mol. Its IUPAC name is propan-2-yl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate.
| Compound Name | propan-2-yl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 90827726 |
| Molecular Formula | C23H24FNO4 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | propan-2-yl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate |
| SMILES | COc1cc2c(CC(=O)OC(C)C)c(C)n(C(=O)c3ccc(C)cc3)c2cc1F |
| InChI | InChI=1S/C23H24FNO4/c1-13(2)29-22(26)11-17-15(4)25(23(27)16-8-6-14(3)7-9-16)20-12-19(24)21(28-5)10-18(17)20/h6-10,12-13H,11H2,1-5H3 |
| InChIKey | APEKHRLZXNVZAG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |