C21H20ClNO4 — CID 91081498
methyl 2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate (PubChem CID 91081498) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is methyl 2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate.
| Compound Name | methyl 2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 91081498 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | methyl 2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)n(C(=O)c2ccc(C)cc2)c2cc(Cl)c(OC)cc12 |
| InChI | InChI=1S/C21H20ClNO4/c1-12-5-7-14(8-6-12)21(25)23-13(2)15(10-20(24)27-4)16-9-19(26-3)17(22)11-18(16)23/h5-9,11H,10H2,1-4H3 |
| InChIKey | CWIMUOURTNFJGL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |