C23H24ClNO4 — CID 91195699
butan-2-yl 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate (PubChem CID 91195699) has the molecular formula C23H24ClNO4 and a molecular weight of 413.90 g/mol. Its IUPAC name is butan-2-yl 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate.
| Compound Name | butan-2-yl 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 91195699 |
| Molecular Formula | C23H24ClNO4 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | butan-2-yl 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzoyl)indol-3-yl]acetate |
| SMILES | CCC(C)OC(=O)Cc1c(C)n(C(=O)c2ccc(C)cc2)c2cc(Cl)c(O)cc12 |
| InChI | InChI=1S/C23H24ClNO4/c1-5-14(3)29-22(27)11-17-15(4)25(20-12-19(24)21(26)10-18(17)20)23(28)16-8-6-13(2)7-9-16/h6-10,12,14,26H,5,11H2,1-4H3 |
| InChIKey | FHFOYNMBTUDDOB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |