C18H15Cl2NO4 — CID 91121279
[6-chloro-3-(2,2-dihydroxyethyl)-5-hydroxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone (PubChem CID 91121279) has the molecular formula C18H15Cl2NO4 and a molecular weight of 380.23 g/mol. Its IUPAC name is [6-chloro-3-(2,2-dihydroxyethyl)-5-hydroxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [6-chloro-3-(2,2-dihydroxyethyl)-5-hydroxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 91121279 |
| Molecular Formula | C18H15Cl2NO4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | [6-chloro-3-(2,2-dihydroxyethyl)-5-hydroxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone |
| SMILES | Cc1c(CC(O)O)c2cc(O)c(Cl)cc2n1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15Cl2NO4/c1-9-12(7-17(23)24)13-6-16(22)14(20)8-15(13)21(9)18(25)10-2-4-11(19)5-3-10/h2-6,8,17,22-24H,7H2,1H3 |
| InChIKey | JZVKMPDEDZMASF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|