C19H13ClF3NO5 — CID 11224105
2-[6-chloro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]acetic acid (PubChem CID 11224105) has the molecular formula C19H13ClF3NO5 and a molecular weight of 427.76 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 11224105 |
| Molecular Formula | C19H13ClF3NO5 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1C(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13ClF3NO5/c1-9-12(7-17(26)27)13-6-16(25)14(20)8-15(13)24(9)18(28)10-2-4-11(5-3-10)29-19(21,22)23/h2-6,8,25H,7H2,1H3,(H,26,27) |
| InChIKey | RKRSDSRRTFQRFO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |