C20H18FNO5 — CID 18453602
2-[1-(4-ethoxybenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid (PubChem CID 18453602) has the molecular formula C20H18FNO5 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-[1-(4-ethoxybenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[1-(4-ethoxybenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453602 |
| Molecular Formula | C20H18FNO5 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[1-(4-ethoxybenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid |
| SMILES | CCOc1ccc(C(=O)n2c(C)c(CC(=O)O)c3cc(O)c(F)cc32)cc1 |
| InChI | InChI=1S/C20H18FNO5/c1-3-27-13-6-4-12(5-7-13)20(26)22-11(2)14(9-19(24)25)15-8-18(23)16(21)10-17(15)22/h4-8,10,23H,3,9H2,1-2H3,(H,24,25) |
| InChIKey | VZBKOUJGHMOOAY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |