C22H19F2NO4 — CID 91054954
cyclobutyl 2-[6-fluoro-1-(4-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate (PubChem CID 91054954) has the molecular formula C22H19F2NO4 and a molecular weight of 399.39 g/mol. Its IUPAC name is cyclobutyl 2-[6-fluoro-1-(4-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate.
| Compound Name | cyclobutyl 2-[6-fluoro-1-(4-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 91054954 |
| Molecular Formula | C22H19F2NO4 |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | cyclobutyl 2-[6-fluoro-1-(4-fluorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate |
| SMILES | Cc1c(CC(=O)OC2CCC2)c2cc(O)c(F)cc2n1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19F2NO4/c1-12-16(10-21(27)29-15-3-2-4-15)17-9-20(26)18(24)11-19(17)25(12)22(28)13-5-7-14(23)8-6-13/h5-9,11,15,26H,2-4,10H2,1H3 |
| InChIKey | HWWZEEUZNBGGMH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |