C24H24FNO3S — CID 91047057
cyclobutyl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetate (PubChem CID 91047057) has the molecular formula C24H24FNO3S and a molecular weight of 425.53 g/mol. Its IUPAC name is cyclobutyl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetate.
| Compound Name | cyclobutyl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 91047057 |
| Molecular Formula | C24H24FNO3S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | cyclobutyl 2-[6-fluoro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetate |
| SMILES | COc1cc2c(CC(=O)OC3CCC3)c(C)n(C(=S)c3ccc(C)cc3)c2cc1F |
| InChI | InChI=1S/C24H24FNO3S/c1-14-7-9-16(10-8-14)24(30)26-15(2)18(12-23(27)29-17-5-4-6-17)19-11-22(28-3)20(25)13-21(19)26/h7-11,13,17H,4-6,12H2,1-3H3 |
| InChIKey | YTPITROHLORZHN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|