C17H18FNO4 — CID 67243595
2-[1-(cyclobutanecarbonyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid (PubChem CID 67243595) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-[1-(cyclobutanecarbonyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[1-(cyclobutanecarbonyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 67243595 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[1-(cyclobutanecarbonyl)-6-fluoro-5-methoxy-2-methylindol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(C(=O)C3CCC3)c2cc1F |
| InChI | InChI=1S/C17H18FNO4/c1-9-11(7-16(20)21)12-6-15(23-2)13(18)8-14(12)19(9)17(22)10-4-3-5-10/h6,8,10H,3-5,7H2,1-2H3,(H,20,21) |
| InChIKey | ZLXBEWJJJZYVIQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |