C24H27ClN2O2S — CID 87854240
N-butan-2-yl-2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetamide (PubChem CID 87854240) has the molecular formula C24H27ClN2O2S and a molecular weight of 443.01 g/mol. Its IUPAC name is N-butan-2-yl-2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 87854240 |
| Molecular Formula | C24H27ClN2O2S |
| Molecular Weight | 443.01 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-butan-2-yl-2-[6-chloro-5-methoxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]acetamide |
| SMILES | CCC(C)NC(=O)Cc1c(C)n(C(=S)c2ccc(C)cc2)c2cc(Cl)c(OC)cc12 |
| InChI | InChI=1S/C24H27ClN2O2S/c1-6-15(3)26-23(28)12-18-16(4)27(24(30)17-9-7-14(2)8-10-17)21-13-20(25)22(29-5)11-19(18)21/h7-11,13,15H,6,12H2,1-5H3,(H,26,28) |
| InChIKey | HEZHKQVMHOXWIR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|