C24H24F4N2O3 — CID 69487191
N-butyl-2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetamide (PubChem CID 69487191) has the molecular formula C24H24F4N2O3 and a molecular weight of 464.46 g/mol. Its IUPAC name is N-butyl-2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetamide.
| Compound Name | N-butyl-2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 69487191 |
| Molecular Formula | C24H24F4N2O3 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-butyl-2-[6-fluoro-5-methoxy-2-methyl-1-[4-(trifluoromethyl)benzoyl]indol-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1c(C)n(C(=O)c2ccc(C(F)(F)F)cc2)c2cc(F)c(OC)cc12 |
| InChI | InChI=1S/C24H24F4N2O3/c1-4-5-10-29-22(31)12-17-14(2)30(20-13-19(25)21(33-3)11-18(17)20)23(32)15-6-8-16(9-7-15)24(26,27)28/h6-9,11,13H,4-5,10,12H2,1-3H3,(H,29,31) |
| InChIKey | ORVAAZTWIPZROL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|