C22H22ClFN2O3 — CID 69485228
N-butyl-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide (PubChem CID 69485228) has the molecular formula C22H22ClFN2O3 and a molecular weight of 416.88 g/mol. Its IUPAC name is N-butyl-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide.
| Compound Name | N-butyl-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 69485228 |
| Molecular Formula | C22H22ClFN2O3 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-butyl-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C22H22ClFN2O3/c1-3-4-9-25-21(28)11-16-13(2)26(19-12-18(24)20(27)10-17(16)19)22(29)14-5-7-15(23)8-6-14/h5-8,10,12,27H,3-4,9,11H2,1-2H3,(H,25,28) |
| InChIKey | FSMIWISKLLHHNA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|