About N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide
N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide (PubChem CID 69485132) has the molecular formula C22H21Cl2FN2O3
and a molecular weight of 451.33 g/mol. Its IUPAC name is N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide |
| PubChem CID | 69485132 |
| Molecular Formula | C22H21Cl2FN2O3 |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)c(Cl)c2)c2ccc(O)c(F)c12 |
| InChI | InChI=1S/C22H21Cl2FN2O3/c1-3-4-9-26-19(29)11-14-12(2)27(17-7-8-18(28)21(25)20(14)17)22(30)13-5-6-15(23)16(24)10-13/h5-8,10,28H,3-4,9,11H2,1-2H3,(H,26,29) |
| InChIKey | PPWOBPRRXZURDP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide?
The IUPAC name of N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide (CID 69485132) is N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide.
What is the SMILES notation for N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide?
The canonical SMILES for N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide is CCCCNC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)c(Cl)c2)c2ccc(O)c(F)c12.
What is the InChIKey of N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide?
The InChIKey is PPWOBPRRXZURDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21Cl2FN2O3/c1-3-4-9-26-19(29)11-14-12(2)27(17-7-8-18(28)21(25)20(14)17)22(30)13-5-6-15(23)16(24)10-13/h5-8,10,28H,3-4,9,11H2,1-2H3,(H,26,29).
What are the key properties of N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide?
N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide has a molecular weight of 451.33 g/mol, XLogP of 5.25, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide is sourced from PubChem (CID 69485132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).