C22H21Cl2FN2O3 — CID 69485132
N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide (PubChem CID 69485132) has the molecular formula C22H21Cl2FN2O3 and a molecular weight of 451.33 g/mol. Its IUPAC name is N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide.
| Compound Name | N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 69485132 |
| Molecular Formula | C22H21Cl2FN2O3 |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-butyl-2-[1-(3,4-dichlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)c(Cl)c2)c2ccc(O)c(F)c12 |
| InChI | InChI=1S/C22H21Cl2FN2O3/c1-3-4-9-26-19(29)11-14-12(2)27(17-7-8-18(28)21(25)20(14)17)22(30)13-5-6-15(23)16(24)10-13/h5-8,10,28H,3-4,9,11H2,1-2H3,(H,26,29) |
| InChIKey | PPWOBPRRXZURDP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|