C21H19ClFNO4 — CID 91359129
propan-2-yl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetate (PubChem CID 91359129) has the molecular formula C21H19ClFNO4 and a molecular weight of 403.84 g/mol. Its IUPAC name is propan-2-yl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetate.
| Compound Name | propan-2-yl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 91359129 |
| Molecular Formula | C21H19ClFNO4 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | propan-2-yl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetate |
| SMILES | Cc1c(CC(=O)OC(C)C)c2c(F)c(O)ccc2n1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClFNO4/c1-11(2)28-18(26)10-15-12(3)24(16-8-9-17(25)20(23)19(15)16)21(27)13-4-6-14(22)7-5-13/h4-9,11,25H,10H2,1-3H3 |
| InChIKey | RWYVLMNVBQEIAK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |