C20H17ClFNO4 — CID 91420812
methyl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate (PubChem CID 91420812) has the molecular formula C20H17ClFNO4 and a molecular weight of 389.81 g/mol. Its IUPAC name is methyl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate.
| Compound Name | methyl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 91420812 |
| Molecular Formula | C20H17ClFNO4 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | methyl 2-[1-(4-chlorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate |
| SMILES | COC(=O)C(C)c1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(O)c(F)c12 |
| InChI | InChI=1S/C20H17ClFNO4/c1-10(20(26)27-3)16-11(2)23(14-8-9-15(24)18(22)17(14)16)19(25)12-4-6-13(21)7-5-12/h4-10,24H,1-3H3 |
| InChIKey | NGQHABSKNNQVQR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |