About 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid
3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid (PubChem CID 69487844) has the molecular formula C22H19F3N2O5
and a molecular weight of 448.40 g/mol. Its IUPAC name is 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid |
| PubChem CID | 69487844 |
| Molecular Formula | C22H19F3N2O5 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid |
| SMILES | Cc1c(C(C)C(=O)NCCC(=O)O)c2c(F)c(O)ccc2n1C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C22H19F3N2O5/c1-10(21(31)26-9-8-16(29)30)17-11(2)27(14-6-7-15(28)20(25)18(14)17)22(32)12-4-3-5-13(23)19(12)24/h3-7,10,28H,8-9H2,1-2H3,(H,26,31)(H,29,30) |
| InChIKey | KIWNXSQEXAOHMR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
The IUPAC name of 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid (CID 69487844) is 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid.
What is the SMILES notation for 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
The canonical SMILES for 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid is Cc1c(C(C)C(=O)NCCC(=O)O)c2c(F)c(O)ccc2n1C(=O)c1cccc(F)c1F.
What is the InChIKey of 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
The InChIKey is KIWNXSQEXAOHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F3N2O5/c1-10(21(31)26-9-8-16(29)30)17-11(2)27(14-6-7-15(28)20(25)18(14)17)22(32)12-4-3-5-13(23)19(12)24/h3-7,10,28H,8-9H2,1-2H3,(H,26,31)(H,29,30).
What are the key properties of 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid?
3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid has a molecular weight of 448.40 g/mol, XLogP of 3.46, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[1-(2,3-difluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]propanoylamino]propanoic acid is sourced from PubChem (CID 69487844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).