C20H18ClFN2O4 — CID 69485260
(2R)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide (PubChem CID 69485260) has the molecular formula C20H18ClFN2O4 and a molecular weight of 404.83 g/mol. Its IUPAC name is (2R)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide.
| Compound Name | (2R)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide |
|---|---|
| PubChem CID | 69485260 |
| Molecular Formula | C20H18ClFN2O4 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (2R)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide |
| SMILES | Cc1c([C@@H](C)C(=O)NCO)c2cc(O)c(F)cc2n1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClFN2O4/c1-10(19(27)23-9-25)18-11(2)24(16-8-15(22)17(26)7-14(16)18)20(28)12-3-5-13(21)6-4-12/h3-8,10,25-26H,9H2,1-2H3,(H,23,27)/t10-/m1/s1 |
| InChIKey | CSBWXHJZBYQTBQ-SNVBAGLBSA-N |
| XLogP | 3.31 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|