C20H17ClF2N2O4 — CID 69488633
(2R)-2-[1-(4-chloro-3-fluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide (PubChem CID 69488633) has the molecular formula C20H17ClF2N2O4 and a molecular weight of 422.82 g/mol. Its IUPAC name is (2R)-2-[1-(4-chloro-3-fluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide.
| Compound Name | (2R)-2-[1-(4-chloro-3-fluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide |
|---|---|
| PubChem CID | 69488633 |
| Molecular Formula | C20H17ClF2N2O4 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (2R)-2-[1-(4-chloro-3-fluorobenzoyl)-4-fluoro-5-hydroxy-2-methylindol-3-yl]-N-(hydroxymethyl)propanamide |
| SMILES | Cc1c([C@@H](C)C(=O)NCO)c2c(F)c(O)ccc2n1C(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H17ClF2N2O4/c1-9(19(28)24-8-26)16-10(2)25(14-5-6-15(27)18(23)17(14)16)20(29)11-3-4-12(21)13(22)7-11/h3-7,9,26-27H,8H2,1-2H3,(H,24,28)/t9-/m1/s1 |
| InChIKey | BMZOLPWORMMILR-SECBINFHSA-N |
| XLogP | 3.44 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|