C21H18F4N2O5 — CID 69485163
(2S)-2-[6-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]-N-(hydroxymethyl)propanamide (PubChem CID 69485163) has the molecular formula C21H18F4N2O5 and a molecular weight of 454.38 g/mol. Its IUPAC name is (2S)-2-[6-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]-N-(hydroxymethyl)propanamide.
| Compound Name | (2S)-2-[6-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]-N-(hydroxymethyl)propanamide |
|---|---|
| PubChem CID | 69485163 |
| Molecular Formula | C21H18F4N2O5 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2S)-2-[6-fluoro-5-hydroxy-2-methyl-1-[4-(trifluoromethoxy)benzoyl]indol-3-yl]-N-(hydroxymethyl)propanamide |
| SMILES | Cc1c([C@H](C)C(=O)NCO)c2cc(O)c(F)cc2n1C(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18F4N2O5/c1-10(19(30)26-9-28)18-11(2)27(16-8-15(22)17(29)7-14(16)18)20(31)12-3-5-13(6-4-12)32-21(23,24)25/h3-8,10,28-29H,9H2,1-2H3,(H,26,30)/t10-/m0/s1 |
| InChIKey | JOPQKIBSPZJPAA-JTQLQIEISA-N |
| XLogP | 3.55 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|