C22H21ClFNO4 — CID 69487810
propan-2-yl (2S)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate (PubChem CID 69487810) has the molecular formula C22H21ClFNO4 and a molecular weight of 417.86 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate.
| Compound Name | propan-2-yl (2S)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 69487810 |
| Molecular Formula | C22H21ClFNO4 |
| Molecular Weight | 417.86 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | propan-2-yl (2S)-2-[1-(4-chlorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]propanoate |
| SMILES | Cc1c([C@H](C)C(=O)OC(C)C)c2cc(O)c(F)cc2n1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClFNO4/c1-11(2)29-22(28)12(3)20-13(4)25(18-10-17(24)19(26)9-16(18)20)21(27)14-5-7-15(23)8-6-14/h5-12,26H,1-4H3/t12-/m0/s1 |
| InChIKey | YNLRKBOZAGWCFJ-LBPRGKRZSA-N |
| XLogP | 5.19 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |