C20H18FNO3S — CID 87990126
2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]propanoic acid (PubChem CID 87990126) has the molecular formula C20H18FNO3S and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]propanoic acid.
| Compound Name | 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 87990126 |
| Molecular Formula | C20H18FNO3S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]propanoic acid |
| SMILES | Cc1ccc(C(=S)n2c(C)c(C(C)C(=O)O)c3cc(O)c(F)cc32)cc1 |
| InChI | InChI=1S/C20H18FNO3S/c1-10-4-6-13(7-5-10)19(26)22-12(3)18(11(2)20(24)25)14-8-17(23)15(21)9-16(14)22/h4-9,11,23H,1-3H3,(H,24,25) |
| InChIKey | VTTNOPSHQVFYRB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|