C22H23FN2O2S — CID 91357277
2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanamide (PubChem CID 91357277) has the molecular formula C22H23FN2O2S and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanamide.
| Compound Name | 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanamide |
|---|---|
| PubChem CID | 91357277 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanamide |
| SMILES | CCCC(C(N)=O)c1c(C)n(C(=S)c2ccc(C)cc2)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C22H23FN2O2S/c1-4-5-15(21(24)27)20-13(3)25(18-11-17(23)19(26)10-16(18)20)22(28)14-8-6-12(2)7-9-14/h6-11,15,26H,4-5H2,1-3H3,(H2,24,27) |
| InChIKey | HXJHEYBAWCOZEL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|