C21H20FNO3S — CID 87990118
2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]butanoic acid (PubChem CID 87990118) has the molecular formula C21H20FNO3S and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]butanoic acid.
| Compound Name | 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 87990118 |
| Molecular Formula | C21H20FNO3S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[6-fluoro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1c(C)n(C(=S)c2ccc(C)cc2)c2cc(F)c(O)cc12 |
| InChI | InChI=1S/C21H20FNO3S/c1-4-14(21(25)26)19-12(3)23(17-10-16(22)18(24)9-15(17)19)20(27)13-7-5-11(2)6-8-13/h5-10,14,24H,4H2,1-3H3,(H,25,26) |
| InChIKey | DKJIHCZLFRTVSS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|