C22H22ClNO3S — CID 87855137
2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanoic acid (PubChem CID 87855137) has the molecular formula C22H22ClNO3S and a molecular weight of 415.94 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanoic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 87855137 |
| Molecular Formula | C22H22ClNO3S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-(4-methylbenzenecarbothioyl)indol-3-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c(C)n(C(=S)c2ccc(C)cc2)c2cc(Cl)c(O)cc12 |
| InChI | InChI=1S/C22H22ClNO3S/c1-4-5-15(22(26)27)20-13(3)24(18-11-17(23)19(25)10-16(18)20)21(28)14-8-6-12(2)7-9-14/h6-11,15,25H,4-5H2,1-3H3,(H,26,27) |
| InChIKey | IWZNUGUOEJSUKD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|