C20H20FNO3 — CID 156877319
2-[1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-methylindol-3-yl]butanoic acid (PubChem CID 156877319) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-[1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-methylindol-3-yl]butanoic acid.
| Compound Name | 2-[1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-methylindol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 156877319 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-methylindol-3-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1c(C)n(-c2ccc(F)c(C)c2)c2ccc(O)cc12 |
| InChI | InChI=1S/C20H20FNO3/c1-4-15(20(24)25)19-12(3)22(13-5-7-17(21)11(2)9-13)18-8-6-14(23)10-16(18)19/h5-10,15,23H,4H2,1-3H3,(H,24,25) |
| InChIKey | JYTSNBCCWFVWSL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |