C23H26FNO2 — CID 156877324
1-(4-fluoro-3-methylphenyl)-3-[3-(hydroxymethyl)cyclobutyl]-2-propan-2-ylindol-5-ol (PubChem CID 156877324) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-3-[3-(hydroxymethyl)cyclobutyl]-2-propan-2-ylindol-5-ol.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-3-[3-(hydroxymethyl)cyclobutyl]-2-propan-2-ylindol-5-ol |
|---|---|
| PubChem CID | 156877324 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-3-[3-(hydroxymethyl)cyclobutyl]-2-propan-2-ylindol-5-ol |
| SMILES | Cc1cc(-n2c(C(C)C)c(C3CC(CO)C3)c3cc(O)ccc32)ccc1F |
| InChI | InChI=1S/C23H26FNO2/c1-13(2)23-22(16-9-15(10-16)12-26)19-11-18(27)5-7-21(19)25(23)17-4-6-20(24)14(3)8-17/h4-8,11,13,15-16,26-27H,9-10,12H2,1-3H3 |
| InChIKey | BHERDCZEYQLIFX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |