C26H28FN3O2 — CID 166782511
(E)-1-[(3R)-3-[5-(4-fluoro-3-methylphenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]cyclopentyl]ethene-1,2-diol (PubChem CID 166782511) has the molecular formula C26H28FN3O2 and a molecular weight of 433.53 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[5-(4-fluoro-3-methylphenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]cyclopentyl]ethene-1,2-diol.
| Compound Name | (E)-1-[(3R)-3-[5-(4-fluoro-3-methylphenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]cyclopentyl]ethene-1,2-diol |
|---|---|
| PubChem CID | 166782511 |
| Molecular Formula | C26H28FN3O2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (E)-1-[(3R)-3-[5-(4-fluoro-3-methylphenyl)-6-propan-2-yl-1H-pyrrolo[2,3-f]indazol-7-yl]cyclopentyl]ethene-1,2-diol |
| SMILES | Cc1cc(-n2c(C(C)C)c([C@@H]3CCC(/C(O)=C\O)C3)c3cc4[nH]ncc4cc32)ccc1F |
| InChI | InChI=1S/C26H28FN3O2/c1-14(2)26-25(17-5-4-16(9-17)24(32)13-31)20-11-22-18(12-28-29-22)10-23(20)30(26)19-6-7-21(27)15(3)8-19/h6-8,10-14,16-17,31-32H,4-5,9H2,1-3H3,(H,28,29)/b24-13+/t16?,17-/m1/s1 |
| InChIKey | DNNOPBLJRLIZJT-KUYWSPJOSA-N |
| XLogP | 6.92 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|