C22H22FNO4 — CID 156877201
ethyl 1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-[(2R)-oxolan-2-yl]indole-3-carboxylate (PubChem CID 156877201) has the molecular formula C22H22FNO4 and a molecular weight of 383.42 g/mol. Its IUPAC name is ethyl 1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-[(2R)-oxolan-2-yl]indole-3-carboxylate.
| Compound Name | ethyl 1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-[(2R)-oxolan-2-yl]indole-3-carboxylate |
|---|---|
| PubChem CID | 156877201 |
| Molecular Formula | C22H22FNO4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl 1-(4-fluoro-3-methylphenyl)-5-hydroxy-2-[(2R)-oxolan-2-yl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c([C@H]2CCCO2)n(-c2ccc(F)c(C)c2)c2ccc(O)cc12 |
| InChI | InChI=1S/C22H22FNO4/c1-3-27-22(26)20-16-12-15(25)7-9-18(16)24(21(20)19-5-4-10-28-19)14-6-8-17(23)13(2)11-14/h6-9,11-12,19,25H,3-5,10H2,1-2H3/t19-/m1/s1 |
| InChIKey | UPJXHXRTQQAKRV-LJQANCHMSA-N |
| XLogP | 4.81 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |