C27H24F2INO2 — CID 166558922
5-fluoro-1-(4-fluoro-3-methylphenyl)-3-iodo-2-(oxan-4-yl)-4-phenylmethoxyindole (PubChem CID 166558922) has the molecular formula C27H24F2INO2 and a molecular weight of 559.39 g/mol. Its IUPAC name is 5-fluoro-1-(4-fluoro-3-methylphenyl)-3-iodo-2-(oxan-4-yl)-4-phenylmethoxyindole.
| Compound Name | 5-fluoro-1-(4-fluoro-3-methylphenyl)-3-iodo-2-(oxan-4-yl)-4-phenylmethoxyindole |
|---|---|
| PubChem CID | 166558922 |
| Molecular Formula | C27H24F2INO2 |
| Molecular Weight | 559.39 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 5-fluoro-1-(4-fluoro-3-methylphenyl)-3-iodo-2-(oxan-4-yl)-4-phenylmethoxyindole |
| SMILES | Cc1cc(-n2c(C3CCOCC3)c(I)c3c(OCc4ccccc4)c(F)ccc32)ccc1F |
| InChI | InChI=1S/C27H24F2INO2/c1-17-15-20(7-8-21(17)28)31-23-10-9-22(29)27(33-16-18-5-3-2-4-6-18)24(23)25(30)26(31)19-11-13-32-14-12-19/h2-10,15,19H,11-14,16H2,1H3 |
| InChIKey | ULRICRMNADPARD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.39 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|