C29H34N2O2 — CID 156878996
ethane;3-methyl-1-(2-methyl-4-pyridinyl)-2-(oxan-4-yl)-4-phenylmethoxyindole (PubChem CID 156878996) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is ethane;3-methyl-1-(2-methyl-4-pyridinyl)-2-(oxan-4-yl)-4-phenylmethoxyindole.
| Compound Name | ethane;3-methyl-1-(2-methyl-4-pyridinyl)-2-(oxan-4-yl)-4-phenylmethoxyindole |
|---|---|
| PubChem CID | 156878996 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | ethane;3-methyl-1-(2-methyl-4-pyridinyl)-2-(oxan-4-yl)-4-phenylmethoxyindole |
| SMILES | CC.Cc1cc(-n2c(C3CCOCC3)c(C)c3c(OCc4ccccc4)cccc32)ccn1 |
| InChI | InChI=1S/C27H28N2O2.C2H6/c1-19-17-23(11-14-28-19)29-24-9-6-10-25(31-18-21-7-4-3-5-8-21)26(24)20(2)27(29)22-12-15-30-16-13-22;1-2/h3-11,14,17,22H,12-13,15-16,18H2,1-2H3;1-2H3 |
| InChIKey | AVKPCNVVBYWDTQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |