C27H25FINO2 — CID 168755181
4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexan-1-ol (PubChem CID 168755181) has the molecular formula C27H25FINO2 and a molecular weight of 541.40 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexan-1-ol.
| Compound Name | 4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 168755181 |
| Molecular Formula | C27H25FINO2 |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2c(I)c3c(OCc4ccccc4)cccc3n2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H25FINO2/c28-20-11-13-21(14-12-20)30-23-7-4-8-24(32-17-18-5-2-1-3-6-18)25(23)26(29)27(30)19-9-15-22(31)16-10-19/h1-8,11-14,19,22,31H,9-10,15-17H2 |
| InChIKey | OTBDJCPDQJCSIP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|