About ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol
ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol (PubChem CID 163370228) has the molecular formula C26H44O2
and a molecular weight of 388.64 g/mol. Its IUPAC name is ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol |
| PubChem CID | 163370228 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol |
| SMILES | C.CC.CC.CC.OC1CCC(c2ccccc2OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H22O2.3C2H6.CH4/c20-17-12-10-16(11-13-17)18-8-4-5-9-19(18)21-14-15-6-2-1-3-7-15;3*1-2;/h1-9,16-17,20H,10-14H2;3*1-2H3;1H4 |
| InChIKey | HUTBPXRAZBAAIU-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol?
The IUPAC name of ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol (CID 163370228) is ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol.
What is the SMILES notation for ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol?
The canonical SMILES for ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol is C.CC.CC.CC.OC1CCC(c2ccccc2OCc2ccccc2)CC1.
What is the InChIKey of ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol?
The InChIKey is HUTBPXRAZBAAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2.3C2H6.CH4/c20-17-12-10-16(11-13-17)18-8-4-5-9-19(18)21-14-15-6-2-1-3-7-15;3*1-2;/h1-9,16-17,20H,10-14H2;3*1-2H3;1H4.
What are the key properties of ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol?
ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol has a molecular weight of 388.64 g/mol, XLogP of 8.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;4-(2-phenylmethoxyphenyl)cyclohexan-1-ol is sourced from PubChem (CID 163370228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).