C23H30O2 — CID 54057558
cis-(1R,3S)-3-(4-tert-butyl-2-phenylmethoxyphenyl)cyclohexan-1-ol (PubChem CID 54057558) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is cis-(1R,3S)-3-(4-tert-butyl-2-phenylmethoxyphenyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-(4-tert-butyl-2-phenylmethoxyphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 54057558 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | cis-(1R,3S)-3-(4-tert-butyl-2-phenylmethoxyphenyl)cyclohexan-1-ol |
| SMILES | CC(C)(C)c1ccc([C@H]2CCC[C@@H](O)C2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H30O2/c1-23(2,3)19-12-13-21(18-10-7-11-20(24)14-18)22(15-19)25-16-17-8-5-4-6-9-17/h4-6,8-9,12-13,15,18,20,24H,7,10-11,14,16H2,1-3H3/t18-,20+/m0/s1 |
| InChIKey | LXIHVZDCCCRQOD-AZUAARDMSA-N |
| XLogP | 5.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |