C29H41NO3 — CID 88605938
(1R,3S,4S)-4-(hydroxyiminomethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol (PubChem CID 88605938) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is (1R,3S,4S)-4-(hydroxyiminomethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol.
| Compound Name | (1R,3S,4S)-4-(hydroxyiminomethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 88605938 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | (1R,3S,4S)-4-(hydroxyiminomethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2C[C@H](O)CC[C@@H]2C=NO)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H41NO3/c1-4-5-6-10-17-29(2,3)24-14-16-26(27-19-25(31)15-13-23(27)20-30-32)28(18-24)33-21-22-11-8-7-9-12-22/h7-9,11-12,14,16,18,20,23,25,27,31-32H,4-6,10,13,15,17,19,21H2,1-3H3/t23-,25-,27+/m1/s1 |
| InChIKey | XAHBBFIKAMPHOU-HYZYYIOASA-N |
| XLogP | 7.22 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|