C29H40O2 — CID 70528766
trans-(3R,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one (PubChem CID 70528766) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is trans-(3R,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one.
| Compound Name | trans-(3R,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 70528766 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | trans-(3R,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2CC(=O)CC[C@H]2C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H40O2/c1-5-6-7-11-18-29(3,4)24-15-17-26(27-20-25(30)16-14-22(27)2)28(19-24)31-21-23-12-9-8-10-13-23/h8-10,12-13,15,17,19,22,27H,5-7,11,14,16,18,20-21H2,1-4H3/t22-,27-/m1/s1 |
| InChIKey | NZARYSKWUGCTRS-AJTFRIOCSA-N |
| XLogP | 7.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|