C31H45NO — CID 54001672
(1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcyclohexan-1-amine (PubChem CID 54001672) has the molecular formula C31H45NO and a molecular weight of 447.71 g/mol. Its IUPAC name is (1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcyclohexan-1-amine.
| Compound Name | (1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcyclohexan-1-amine |
|---|---|
| PubChem CID | 54001672 |
| Molecular Formula | C31H45NO |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (1R,3R,4S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-4-prop-2-enylcyclohexan-1-amine |
| SMILES | C=CC[C@@H]1CC[C@@H](N)C[C@H]1c1ccc(C(C)(C)CCCCCC)cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H45NO/c1-5-7-8-12-20-31(3,4)26-17-19-28(29-22-27(32)18-16-25(29)13-6-2)30(21-26)33-23-24-14-10-9-11-15-24/h6,9-11,14-15,17,19,21,25,27,29H,2,5,7-8,12-13,16,18,20,22-23,32H2,1,3-4H3/t25-,27-,29-/m1/s1 |
| InChIKey | KMBDFWWBKNOOQW-ONDZYYNLSA-N |
| XLogP | 8.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|