C30H42O3 — CID 70360113
cis-(3S,4R)-4-(2-hydroxyethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one (PubChem CID 70360113) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is cis-(3S,4R)-4-(2-hydroxyethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one.
| Compound Name | cis-(3S,4R)-4-(2-hydroxyethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 70360113 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | cis-(3S,4R)-4-(2-hydroxyethyl)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-one |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2CC(=O)CC[C@@H]2CCO)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H42O3/c1-4-5-6-10-18-30(2,3)25-14-16-27(28-21-26(32)15-13-24(28)17-19-31)29(20-25)33-22-23-11-8-7-9-12-23/h7-9,11-12,14,16,20,24,28,31H,4-6,10,13,15,17-19,21-22H2,1-3H3/t24-,28+/m1/s1 |
| InChIKey | MHKCQKFZWALYOT-YWEHKCAJSA-N |
| XLogP | 7.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|