C29H40O2 — CID 19855395
3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cycloheptan-1-one (PubChem CID 19855395) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is 3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cycloheptan-1-one.
| Compound Name | 3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cycloheptan-1-one |
|---|---|
| PubChem CID | 19855395 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | 3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cycloheptan-1-one |
| SMILES | CCCCCCC(C)(C)c1ccc(C2CCCCC(=O)C2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H40O2/c1-4-5-6-12-19-29(2,3)25-17-18-27(24-15-10-11-16-26(30)20-24)28(21-25)31-22-23-13-8-7-9-14-23/h7-9,13-14,17-18,21,24H,4-6,10-12,15-16,19-20,22H2,1-3H3 |
| InChIKey | WDAFOIJWEXFWDF-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|