C29H38O2 — CID 12788294
3-methyl-5-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohex-2-en-1-one (PubChem CID 12788294) has the molecular formula C29H38O2 and a molecular weight of 418.62 g/mol. Its IUPAC name is 3-methyl-5-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohex-2-en-1-one.
| Compound Name | 3-methyl-5-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 12788294 |
| Molecular Formula | C29H38O2 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 3-methyl-5-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohex-2-en-1-one |
| SMILES | CCCCCCC(C)(C)c1ccc(C2CC(=O)C=C(C)C2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H38O2/c1-5-6-7-11-16-29(3,4)25-14-15-27(24-17-22(2)18-26(30)19-24)28(20-25)31-21-23-12-9-8-10-13-23/h8-10,12-15,18,20,24H,5-7,11,16-17,19,21H2,1-4H3 |
| InChIKey | BUKCPAFWHCDSGV-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|