C29H42O2 — CID 54069720
(1R,3S,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol (PubChem CID 54069720) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (1R,3S,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol.
| Compound Name | (1R,3S,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 54069720 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (1R,3S,4R)-4-methyl-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]cyclohexan-1-ol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2C[C@H](O)CC[C@H]2C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H42O2/c1-5-6-7-11-18-29(3,4)24-15-17-26(27-20-25(30)16-14-22(27)2)28(19-24)31-21-23-12-9-8-10-13-23/h8-10,12-13,15,17,19,22,25,27,30H,5-7,11,14,16,18,20-21H2,1-4H3/t22-,25-,27+/m1/s1 |
| InChIKey | MFODEJFEEDULLM-JBBQQGGESA-N |
| XLogP | 7.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|