C29H37NO2 — CID 70359890
cis-(1R,3S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-5-oxocyclohexane-1-carbonitrile (PubChem CID 70359890) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is cis-(1R,3S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-5-oxocyclohexane-1-carbonitrile.
| Compound Name | cis-(1R,3S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-5-oxocyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 70359890 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | cis-(1R,3S)-3-[4-(2-methyloctan-2-yl)-2-phenylmethoxyphenyl]-5-oxocyclohexane-1-carbonitrile |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2CC(=O)C[C@H](C#N)C2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H37NO2/c1-4-5-6-10-15-29(2,3)25-13-14-27(24-16-23(20-30)17-26(31)18-24)28(19-25)32-21-22-11-8-7-9-12-22/h7-9,11-14,19,23-24H,4-6,10,15-18,21H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | HUIOYVZYETYQPK-RPWUZVMVSA-N |
| XLogP | 7.49 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|