C24H38O2 — CID 12788301
cis-(3R,5S)-3-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-5-propylcyclohexan-1-one (PubChem CID 12788301) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is cis-(3R,5S)-3-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-5-propylcyclohexan-1-one.
| Compound Name | cis-(3R,5S)-3-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-5-propylcyclohexan-1-one |
|---|---|
| PubChem CID | 12788301 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | cis-(3R,5S)-3-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]-5-propylcyclohexan-1-one |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2CC(=O)C[C@@H](CCC)C2)c(O)c1 |
| InChI | InChI=1S/C24H38O2/c1-5-7-8-9-13-24(3,4)20-11-12-22(23(26)17-20)19-14-18(10-6-2)15-21(25)16-19/h11-12,17-19,26H,5-10,13-16H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | AQUVJQBNWOEBJQ-RBUKOAKNSA-N |
| XLogP | 6.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|