C23H38O2 — CID 100924322
2-[(1R,2R,5R)-2-ethyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 100924322) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-[(1R,2R,5R)-2-ethyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(1R,2R,5R)-2-ethyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 100924322 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 2-[(1R,2R,5R)-2-ethyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CC)c(O)c1 |
| InChI | InChI=1S/C23H38O2/c1-5-7-8-9-14-23(3,4)18-11-13-20(22(25)15-18)21-16-19(24)12-10-17(21)6-2/h11,13,15,17,19,21,24-25H,5-10,12,14,16H2,1-4H3/t17-,19-,21-/m1/s1 |
| InChIKey | FQRGHLOTHFXGTA-YFVAEKQCSA-N |
| XLogP | 6.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|