C25H42O2 — CID 54204170
2-[(1S,2S,5R)-2-butyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 54204170) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 2-[(1S,2S,5R)-2-butyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(1S,2S,5R)-2-butyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 54204170 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 2-[(1S,2S,5R)-2-butyl-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2C[C@H](O)CC[C@@H]2CCCC)c(O)c1 |
| InChI | InChI=1S/C25H42O2/c1-5-7-9-10-16-25(3,4)20-13-15-22(24(27)17-20)23-18-21(26)14-12-19(23)11-8-6-2/h13,15,17,19,21,23,26-27H,5-12,14,16,18H2,1-4H3/t19-,21+,23-/m0/s1 |
| InChIKey | PRIKFDIWFVFEQP-WPYKKVEZSA-N |
| XLogP | 7.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|