C24H38O4 — CID 13105184
3-[(1S,2R,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexyl]propanoic acid (PubChem CID 13105184) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 3-[(1S,2R,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexyl]propanoic acid.
| Compound Name | 3-[(1S,2R,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 13105184 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 3-[(1S,2R,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexyl]propanoic acid |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CCC(=O)O)c(O)c1 |
| InChI | InChI=1S/C24H38O4/c1-4-5-6-7-14-24(2,3)18-10-12-20(22(26)15-18)21-16-19(25)11-8-17(21)9-13-23(27)28/h10,12,15,17,19,21,25-26H,4-9,11,13-14,16H2,1-3H3,(H,27,28)/t17-,19+,21+/m0/s1 |
| InChIKey | ULBYYRKOSDZAJX-FBBABVLZSA-N |
| XLogP | 5.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|