C26H45NO2 — CID 13105195
2-[(1R,2R,5R)-2-[3-(dimethylamino)propyl]-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 13105195) has the molecular formula C26H45NO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 2-[(1R,2R,5R)-2-[3-(dimethylamino)propyl]-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(1R,2R,5R)-2-[3-(dimethylamino)propyl]-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 13105195 |
| Molecular Formula | C26H45NO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.35 |
| IUPAC Name | 2-[(1R,2R,5R)-2-[3-(dimethylamino)propyl]-5-hydroxycyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CC[C@H]2CCCN(C)C)c(O)c1 |
| InChI | InChI=1S/C26H45NO2/c1-6-7-8-9-16-26(2,3)21-13-15-23(25(29)18-21)24-19-22(28)14-12-20(24)11-10-17-27(4)5/h13,15,18,20,22,24,28-29H,6-12,14,16-17,19H2,1-5H3/t20-,22-,24-/m1/s1 |
| InChIKey | FDAXOTUKIXPPTJ-KIFXHHALSA-N |
| XLogP | 6.23 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|