C24H38O2 — CID 12788284
2-[(1S,2R,5R)-5-hydroxy-2-prop-2-enylcyclohexyl]-5-(2-methyloctan-2-yl)phenol (PubChem CID 12788284) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[(1S,2R,5R)-5-hydroxy-2-prop-2-enylcyclohexyl]-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-[(1S,2R,5R)-5-hydroxy-2-prop-2-enylcyclohexyl]-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 12788284 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 2-[(1S,2R,5R)-5-hydroxy-2-prop-2-enylcyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| SMILES | C=CC[C@H]1CC[C@@H](O)C[C@@H]1c1ccc(C(C)(C)CCCCCC)cc1O |
| InChI | InChI=1S/C24H38O2/c1-5-7-8-9-15-24(3,4)19-12-14-21(23(26)16-19)22-17-20(25)13-11-18(22)10-6-2/h6,12,14,16,18,20,22,25-26H,2,5,7-11,13,15,17H2,1,3-4H3/t18-,20+,22-/m0/s1 |
| InChIKey | UECNXHCBRXLLJG-DWLFOUALSA-N |
| XLogP | 6.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|