C25H40O2 — CID 57384417
(1R,3R,4S)-3-[2-methoxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-2-enylcyclohexan-1-ol (PubChem CID 57384417) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (1R,3R,4S)-3-[2-methoxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-2-enylcyclohexan-1-ol.
| Compound Name | (1R,3R,4S)-3-[2-methoxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 57384417 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (1R,3R,4S)-3-[2-methoxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@@H]1CC[C@@H](O)C[C@H]1c1ccc(C(C)(C)CCCCCC)cc1OC |
| InChI | InChI=1S/C25H40O2/c1-6-8-9-10-16-25(3,4)20-13-15-22(24(17-20)27-5)23-18-21(26)14-12-19(23)11-7-2/h7,13,15,17,19,21,23,26H,2,6,8-12,14,16,18H2,1,3-5H3/t19-,21-,23-/m1/s1 |
| InChIKey | DUWKIPDVCFJFQP-KJXAQDMKSA-N |
| XLogP | 6.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|