C23H36O2 — CID 12788299
cis-(3S,5R)-3-ethyl-5-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-one (PubChem CID 12788299) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is cis-(3S,5R)-3-ethyl-5-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-one.
| Compound Name | cis-(3S,5R)-3-ethyl-5-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 12788299 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | cis-(3S,5R)-3-ethyl-5-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]cyclohexan-1-one |
| SMILES | CCCCCCC(C)(C)c1ccc([C@H]2CC(=O)C[C@@H](CC)C2)c(O)c1 |
| InChI | InChI=1S/C23H36O2/c1-5-7-8-9-12-23(3,4)19-10-11-21(22(25)16-19)18-13-17(6-2)14-20(24)15-18/h10-11,16-18,25H,5-9,12-15H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | VMBIELHPJIUTAR-ZWKOTPCHSA-N |
| XLogP | 6.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|