C22H35NO4 — CID 54199905
methyl (2S,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidine-1-carboxylate (PubChem CID 54199905) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is methyl (2S,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54199905 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | methyl (2S,4R)-4-hydroxy-2-[2-hydroxy-4-(2-methyloctan-2-yl)phenyl]piperidine-1-carboxylate |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O)CCN2C(=O)OC)c(O)c1 |
| InChI | InChI=1S/C22H35NO4/c1-5-6-7-8-12-22(2,3)16-9-10-18(20(25)14-16)19-15-17(24)11-13-23(19)21(26)27-4/h9-10,14,17,19,24-25H,5-8,11-13,15H2,1-4H3/t17-,19+/m1/s1 |
| InChIKey | POMHQBJGMCEOCP-MJGOQNOKSA-N |
| XLogP | 4.90 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|